Loratadine 10mM * 1mL in DMSO
Loratadine is a non-sedative antihistamine that inhibits histamine-induced activities of IL-6 and IL-8 secretion in endothelial cells. Loratadine is a selective inverse peripheral histamine H1-receptor agonist with an IC50 of >32 ??M.
| Trivial name | Loratadine 10mM * 1mL in DMSO |
| Catalog Number | A10538-10mM-D |
| Alternative Name(s) | Ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate; 4-(8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene-1-piperidinecarboxylic acid ethyl ester |
| Molecular Formula | C22H23ClN2O2 |
| CAS# | 79794-75-5 |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/loratadine.html |