Letrozole 10mM * 1mL in DMSO
Letrozole is an Aromatase inhibitor. CGS 20267 is a new non-steroidal compound which potently inhibits aromatase in vitro (IC50 of 11.5 nM) and in vivo (ED50 of 1?€?3 ??g/kg p.o.)
| Trivial name | Letrozole 10mM * 1mL in DMSO |
| Catalog Number | A10523-10mM-D |
| Alternative Name(s) | 4,4'-(1H-1,2,4-Triazol-1-ylmethylene)bisbenzonitrile |
| Molecular Formula | C17H11N5 |
| CAS# | 112809-51-5 |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3C=NC=N3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/letrozole.html |