LDE225 (NVP-LDE225) 10mM * 1mL in DMSO
LDE225 (NVP-LDE225) is a potent, selective and orally bioavailable Smoothened (SMO) antagonist that inhibits hedgehog (Hh) signaling pathway via antagonism of the Smoothened receptor (SMO).
| Trivial name | LDE225 (NVP-LDE225) 10mM * 1mL in DMSO |
| Catalog Number | A10520-10mM-D |
| Alternative Name(s) | rel-N-[6-[(2R,6S)-2,6-Dimethyl-4-morpholinyl]-3-pyridinyl]-2-methyl-4'-(trifluoromethoxy)-[1,1'-biphenyl]-3-carboxamide |
| Molecular Formula | C26H26F3N3O3 |
| CAS# | 956697-53-3 |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2=NC=C(C=C2)NC(=O)C3=CC=CC(=C3C)C4=CC=C(C=C4)OC(F)(F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/lde225-nvp-lde225.html |