Isotretinoin 10mM * 1mL in DMSO
Isotretinoin was developed to be used as a chemotherapy medication for the treatment of brain cancer, pancreatic cancer and more.
| Trivial name | Isotretinoin 10mM * 1mL in DMSO |
| Catalog Number | A10485-10mM-D |
| Alternative Name(s) | (2Z,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic Acid |
| Molecular Formula | C20H28O2 |
| CAS# | 4759-48-2 |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=CC(=O)O)/C)/C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/isotretinoin.html |
