Icariin 10mM * 1mL in DMSO
Icariin is inhibitory to all three PDE5 isoforms that inhibits PDE5A1, A2, and A3 with an IC50 value of 1.0, 0.75, and 1.1 microM, respectively.
Trivial name | Icariin 10mM * 1mL in DMSO |
Catalog Number | A10464-10mM-D |
Alternative Name(s) | 5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
Molecular Formula | C33H40O15 |
CAS# | 489-32-7 |
SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/icariin.html |