Hyodeoxycholic acid 10mM * 1mL in DMSO
Hyodeoxycholic (HDCA) acid is a secondary bile acid, one of the metabolic byproducts of intestinal bacteria.
Trivial name | Hyodeoxycholic acid 10mM * 1mL in DMSO |
Catalog Number | A10460-10mM-D |
Alternative Name(s) | 4-[(5R,8S,10R,13R,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
Molecular Formula | C24H40O4 |
CAS# | 83-49-8 |
SMILES | C[C@H](CCC(=O)O)[C@@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H]([C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/hyodeoxycholic-acid.html |