Honokiol 5mg
Honokiol is a lignan present in the cones, bark, and leaves of Magnolia grandiflora that has shown pro-apoptotic effects in melanoma, sarcoma, myeloma, leukemia, bladder, lung, prostate, oral squamous cell carcinoma and colon cancer cell lines.
| Trivial name | Honokiol 5mg |
| Catalog Number | A10453-5 |
| Alternative Name(s) | 2-(4-hydroxy-3-prop-2-enyl-phenyl)- 4-prop-2-enyl-phenol |
| Molecular Formula | C18H18O2 |
| CAS# | 35354-74-6 |
| SMILES | C=CCC1=CC(=C(C=C1)O)C2=CC(=C(C=C2)O)CC=C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/honokiol.html |