Hexestrol 10mM * 1mL in DMSO
Hexestrol is a carcinogenic synthetic estrogen that inhibits microtubule polymerization and the formation of ribbon structures. It is an inhibitor of lipid peroxidation.
Trivial name | Hexestrol 10mM * 1mL in DMSO |
Catalog Number | A10451-10mM-D |
Alternative Name(s) | 4,4'-(1,2-Diethylethylene)diphenol |
Molecular Formula | C18H22O2 |
CAS# | 84-16-2 |
SMILES | CCC(C1=CC=C(C=C1)O)C(CC)C2=CC=C(C=C2)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/hexestrol.html |