Hematoxylin 25mg
Haematoxylin is extracted from the heartwood of the logwood tree.When oxidized it forms haematein, a compound that forms strongly coloured complexes with certain metal ions, the most notable ones being Fe(III) and Al(III) salts. Metal-haematein complexes are used to stain cell nuclei prior to examination under a microscope.
Trivial name | Hematoxylin 25mg |
Catalog Number | A10447-25 |
Alternative Name(s) | 7,11b-dihydroindeno[2,1-c]chromene-3,4,6a,9,10(6H)-pentol |
Molecular Formula | C16H14O6 |
CAS# | 517-28-2 |
SMILES | C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O |
Size | 25mg |
Supplier Page | http://www.adooq.com/hematoxylin-hydroxybrazilin.html |