Genistin 100mg
Genistin is an isoflavone found in a number of dietary plants like soy and kudzu. It was shown to stimulate estrogen-dependent breast cancer cell growth in vivo.
| Trivial name | Genistin 100mg |
| Catalog Number | A10426-100 |
| Alternative Name(s) | 5-hydroxy-3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Molecular Formula | C21H20O10 |
| CAS# | 529-59-9 |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/genistin-genistoside.html |