Gemcitabine HCl 25mg
Gemcitabine (Gemzar) is a newer chemotherapy drug acting by replacing one of the building blocks of nucleic acids during DNA replication in cancer cells, preventing tumor growth.
| Trivial name | Gemcitabine HCl 25mg |
| Catalog Number | A10423-25 |
| Alternative Name(s) | 4-Amino-1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1H-pyrimidin-2-one hydrochloride |
| Molecular Formula | C9H11F2N3O4.HCI |
| CAS# | 122111-03-9 |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/gemcitabine-hcl-gemzar.html |