Tegafur 10mM * 1mL in DMSO
Tegafur is a chemotherapeutic 5-FU prodrug used in the treatment of cancers. It is a component of tegafur-uracil.
| Trivial name | Tegafur 10mM * 1mL in DMSO |
| Catalog Number | A10407-10mM-D |
| Alternative Name(s) | 5-fluoro-1-(tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Molecular Formula | C8H9FN2O3 |
| CAS# | 17902-23-7 |
| SMILES | C1CC(OC1)N2C=C(C(=O)NC2=O)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tegafur.html |