Fisetin 2g
Fisetin is a flavonol, a structurally distinct chemical substance that belongs to the flavonoid group of polyphenols. It can be found in many plants, where it serves as a colouring agent. Possible anti-aging, anti-inflammatory, anti-cancer, and anti-viral properties of fisetin are under active scientific investigation.
| Trivial name | Fisetin 2g |
| Catalog Number | A10388-2000 |
| Alternative Name(s) | 2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
| Molecular Formula | C15H10O6 |
| CAS# | 528-48-3 |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
| Size | 2000mg |
| Supplier Page | http://www.adooq.com/fisetin-fustel.html |
