Ezetimibe (Zetia) 10mM * 1mL in DMSO
Ezetimibe is a compound that lowers cholesterol. It acts by decreasing cholesterol absorption in the intestine. Ezetimibe localises at the brush border of the small intestine, where ezetimibe inhibits the absorption of cholesterol from the intestine.
| Trivial name | Ezetimibe (Zetia) 10mM * 1mL in DMSO |
| Catalog Number | A10379-10mM-D |
| Alternative Name(s) | (3R,4S)-1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| Molecular Formula | C24H21F2NO3 |
| CAS# | 163222-33-1 |
| SMILES | C1=CC(=CC=C1[C@@H]2[C@H](C(=O)N2C3=CC=C(C=C3)F)CC[C@@H](C4=CC=C(C=C4)F)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ezetimibe-zetia.html |