Exemestane 10mM * 1mL in DMSO
Exemestane is an oral steroidal aromatase inhibitor that is used in ER-positive breast cancer in addition to surgery and/or radiation in post-menopausal women.
| Trivial name | Exemestane 10mM * 1mL in DMSO |
| Catalog Number | A10378-10mM-D |
| Alternative Name(s) | 6-Methylideneandrosta-1,4-diene-3,17-dione |
| Molecular Formula | C20H24O2 |
| CAS# | 107868-30-4 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=C)C4=CC(=O)C=C[C@]34C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/exemestane.html |
