Etoposide 500mg
Etoposide forms a ternary complex with DNA and the topoisomerase II enzyme (which aids in DNA unwinding), prevents re-ligation of the DNA strands, and by doing so causes DNA strands to break. Therefore, this causes errors in DNA synthesis and promotes apoptosis of the cancer cell.
| Trivial name | Etoposide 500mg |
| Catalog Number | A10373-500 |
| Alternative Name(s) | 4'-demethyl-epipodophyllotoxin 9-[4,6-O-(R)-ethylidene-beta-D-glucopyranoside], 4' -(dihydrogen phosphate) |
| Molecular Formula | C29H32O13 |
| CAS# | 33419-42-0 |
| SMILES | C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/etoposide-vp-16.html |
