Epothilone A 10mM * 1mL in DMSO
Epothilone A acts by stabilising microtubule formation at the taxol binding site and causes cell cycle arrest at the G2/M transition, leading to cytotoxicity.
Trivial name | Epothilone A 10mM * 1mL in DMSO |
Catalog Number | A10359-10mM-D |
Alternative Name(s) | (1S,3S,7S,10R,11S,12S,16R)-7,11-Dihydroxy-8,8,10,12-tetramethyl-3-[(1E)-1-methyl-2-(2-methyl-4-thiazolyl)ethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
Molecular Formula | C26H39NO6S |
CAS# | 152044-53-6 |
SMILES | C[C@H]1CCC[C@@H]2[C@@H](O2)C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C3=CSC(=N3)C)/C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/epothilone-a.html |