Glycyrrhetinic acid 10mM * 1mL in DMSO
Glycyrrhetinic acid inhibits the enzymes (15-hydroxyprostaglandin dehydrogenase and delta-13-prostaglandin) that metabolize the prostaglandins PGE-2 and PGF-2?? to their respective 15-keto-13,14-dihydro metabolites which are inactive.
| Trivial name | Glycyrrhetinic acid 10mM * 1mL in DMSO |
| Catalog Number | A10353-10mM-D |
| Alternative Name(s) | 3b-Hydroxy-11-oxo-18b,20b-olean-12-en-29-oic acid |
| Molecular Formula | C30H46O4 |
| CAS# | 471-53-4 |
| SMILES | C[C@]12CC[C@](C[C@H]1C3=CC(=O)[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)(C)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/glycyrrhetinic-acid-enoxolone.html |