Emodin 50mg
Emodin is a purgative resin, from rhubarb, the buckthorn and Japanese Knotweed (Fallopia japonica). It belongs to a family of compounds called anthraquinones, which have shown anti-inflammatory and anticancer effects
| Trivial name | Emodin 50mg |
| Catalog Number | A10348-50 |
| Alternative Name(s) | 6-methyl-1,3,8-trihydroxyanthraquinone |
| Molecular Formula | C15H10O5 |
| CAS# | 518-82-1 |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/emodin.html |