Epirubicin Hydrochloride 10mM * 1mL in DMSO
Epirubicin is a cell-permeable anthracycline antitumor antibiotic. It is a stereoisomer(4?€?-epi-isomer) of doxorubicin that exhibits reduced cardiotoxicity. It is used to inhibit topoisomerase II and DNA helicase activity.
| Trivial name | Epirubicin Hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A10345-10mM-D |
| Alternative Name(s) | (8S-cis)-10-[(3-Amino-2,3,6-trideoxy-alpha-L-arabino-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,8,11-trihydroxy-8-(hydroxyacetyl)-1-methoxynaphthacene-5,12-dione hydrochloride |
| Molecular Formula | C27H30ClNO11 |
| CAS# | 56390-09-1 |
| SMILES | C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)CO)O)N)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/epirubicin-hydrochloride.html |