Ellagic acid 500mg
Ellagic acid is a natural phenol antioxidant found in numerous fruits and vegetables. The antiproliferative and antioxidant properties of ellagic acid have spurred preliminary research into the potential health benefits of ellagic acid consumption.
| Trivial name | Ellagic acid 500mg |
| Catalog Number | A10344-500 |
| Alternative Name(s) | 2,3,7,8-Tetrahydroxy-chromeno[5,4,3-cde]chromene-5,10-dione |
| Molecular Formula | C14H6O8 |
| CAS# | 476-66-4 |
| SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/ellagic-acid.html |