Dyphylline 10mM * 1mL in DMSO
Dyphylline is a xanthine derivative with bronchodilator and vasodilator effects. It acts as an adenosine receptor antagonist and phosphodiesterase inhibitor.
| Trivial name | Dyphylline 10mM * 1mL in DMSO |
| Catalog Number | A10339-10mM-D |
| Alternative Name(s) | 7-(2,3-Dihydroxypropyl)theophylline; 7-(2,3-Dihydroxypropyl)-1,3-dimethyl-purine-2,6-dione |
| Molecular Formula | C10H14N4O4 |
| CAS# | 479-18-5 |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dyphylline.html |