Disulfiram 10mM * 1mL in DMSO
Disulfiram blocks the processing of alcohol in the body by inhibiting acetaldehyde dehydrogenase thus causing an unpleasant reaction when alcohol is consumed.
| Trivial name | Disulfiram 10mM * 1mL in DMSO |
| Catalog Number | A10320-10mM-D |
| Alternative Name(s) | 1,1',1'',1'''-[disulfanediylbis(carbonothioylnitrilo)]tetraethane |
| Molecular Formula | C10H20N2S4 |
| CAS# | 97-77-8 |
| SMILES | CCN(CC)C(=S)SSC(=S)N(CC)CC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/disulfiram.html |