Dioscin (Collettiside III) 10mM * 1mL in DMSO
Dioscin (Collettiside III) is extracted and isolated from Polygonatum Zanlanscianense Pamp with IC50 of 2.6, 0.8, 7.5, and 4.5 ??M for the inhibition of the growth of the MDA-MB-435, H14, HL60, and HeLa cell lines, respectively.
| Trivial name | Dioscin (Collettiside III) 10mM * 1mL in DMSO |
| Catalog Number | A10314-10mM-D |
| Alternative Name(s) | Diosgenin bis-alpha-L-rhamnopyranosyl)-(1-2 and 1-4)-beta-D-glucopyranoside |
| Molecular Formula | C45H72O16 |
| CAS# | 19057-60-4 |
| SMILES | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)OC1 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dioscin-collettiside-iii.html |