Didanosine 10mM * 1mL in DMSO
Didanosine is a reverse transcriptase inhibitor, effective against HIV and used in combination with other antiretroviral drug therapy as part of highly active antiretroviral therapy (HAART).
Trivial name | Didanosine 10mM * 1mL in DMSO |
Catalog Number | A10306-10mM-D |
Alternative Name(s) | 2',3'-Dideoxyinosine |
Molecular Formula | C10H12N4O3 |
CAS# | 69655-05-6 |
SMILES | C1C[C@@H](O[C@@H]1CO)N2C=NC3=C2NC=NC3=O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/didanosine.html |