Diclofenac sodium 10mM * 1mL in DMSO
Diclofenac is a nonsteroidal anti-inflammatory drug (NSAID) taken to reduce inflammation and as an analgesic reducing pain in certain conditions.
| Trivial name | Diclofenac sodium 10mM * 1mL in DMSO |
| Catalog Number | A10304-10mM-D |
| Alternative Name(s) | 2-[(2,6-Dichlorophenyl)amino]benzeneacetic acid sodium salt |
| Molecular Formula | C14H10Cl2NNaO2 |
| CAS# | 15307-79-6 |
| SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/diclofenac-sodium.html |