Dexrazoxane Hydrochloride 10mM * 1mL in DMSO
Dexrazoxane hydrochloride is a cardioprotective agent. As a derivative of EDTA, dexrazoxane chelates iron, but the precise mechanism by which it protects the heart is not known. This agent is used to protect the heart against the cardiotoxic side effects of anthracyclines, such as doxorubicin.
Trivial name | Dexrazoxane Hydrochloride 10mM * 1mL in DMSO |
Catalog Number | A10300-10mM-D |
Alternative Name(s) | (S)-4,4'-(1-Methyl-1,2-ethanediyl)bis-2,6-piperazinedione hydrochloride,,,,, |
Molecular Formula | C11H17ClN4O4 |
CAS# | 149003-01-0 |
SMILES | C[C@@H](CN1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/dexrazoxane-hydrochloride.html |