Dexamethasone 500mg
Dexamethasone is a potent synthetic member of the glucocorticoid class of steroid drugs. It acts as an anti-inflammatory and immunosuppressant. Its potency is about 20-30 times that of the naturally occurring hormone hydrocortisone and 4-5 times of prednisone.
| Trivial name | Dexamethasone 500mg |
| Catalog Number | A10299-500 |
| Alternative Name(s) | 9alpha-Fluoro-11beta,17alpha,21-trihydroxy-16alpha-methylpregn-1,4-diene-3,20-dione |
| Molecular Formula | C22H29FO5 |
| CAS# | 50-02-2 |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/dexamethasone.html |
