DAPT (GSI-IX) 10mM * 1mL in DMSO
DAPT (GSI-IX) is an inhibitor of ??-secretase that causes a reduction in A??40 and A??42 levels in human primary neuronal cultures with IC50 values of 115 and 200 nM for total A?? and A??42 respectively.
| Trivial name | DAPT (GSI-IX) 10mM * 1mL in DMSO |
| Catalog Number | A10288-10mM-D |
| Alternative Name(s) | N-[(3,5-Difluorophenyl)acetyl]-L-alanyl-2-phenyl]glycine-1,1-dimethylethyl ester |
| Molecular Formula | C23H26F2N2O4 |
| CAS# | 208255-80-5 |
| SMILES | C[C@@H](C(=O)N[C@@H](C1=CC=CC=C1)C(=O)OC(C)(C)C)NC(=O)CC2=CC(=CC(=C2)F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dapt-gsi-ix.html |