Dapoxetine hydrochloride 10mM * 1mL in DMSO
Dapoxetine works by inhibiting serotonin transporter, increasing serotonins action at the post synaptic cleft, and as a consequence promoting ejaculatory delay.
| Trivial name | Dapoxetine hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A10287-10mM-D |
| Alternative Name(s) | (1S)-N,N-Dimethyl-3-naphthalen-1-yloxy-1-phenyl-propan-1-amine hydrochloride |
| Molecular Formula | C21H23NO.HCl |
| CAS# | 129938-20-1 |
| SMILES | CN(C)[C@@H](CCOC1=CC=CC2=CC=CC=C21)C3=CC=CC=C3.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dapoxetine-hydrochloride.html |