Dapagliflozin (BMS512148) 10mM * 1mL in DMSO
Dapagliflozin inhibits subtype 2 of the sodium-glucose transport proteins (SGLT2), which is responsible for at least 90% of the glucose reabsorption in the kidney.
| Trivial name | Dapagliflozin (BMS512148) 10mM * 1mL in DMSO |
| Catalog Number | A10285-10mM-D |
| Alternative Name(s) | (2S,3R,4R,5S,6R)-2-[4-chloro-3-(4-ethoxybenzyl)phenyl]-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| Molecular Formula | C21H25ClO6 |
| CAS# | 461432-26-8 |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dapagliflozin.html |