Cytisine 10mM * 1mL in DMSO
Cytisine is a nicotinic acetylcholine receptor agonist, and as a pharmaceutical preparation it is available for the treatment of nicotinism. It is a pyridine-like alkaloid that can be toxic in high doses. Pharmacologically it exhibits similar effects to nicotine due to structural similarity of the two molecules.
| Trivial name | Cytisine 10mM * 1mL in DMSO |
| Catalog Number | A10266-10mM-D |
| Alternative Name(s) | (1R,5S)-1,2,3,4,5,6-Hexahydro-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
| Molecular Formula | C11H14N2O |
| CAS# | 485-35-8 |
| SMILES | C1[C@H]2CNC[C@@H]1C3=CC=CC(=O)N3C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cytisine-baphitoxine-sophorine.html |