PD0325901 10mM * 1mL in DMSO
PD0325901 is MEK inhibitor and non-competitive with ATP, Kiapp of 1 nM against activated MEK1 and MEK2.
| Trivial name | PD0325901 10mM * 1mL in DMSO |
| Catalog Number | A10256-10mM-D |
| Alternative Name(s) | N-[(2R)-2,3-Dihydroxypropoxy]-3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]-benzamide |
| Molecular Formula | C16H14F3IN2O4 |
| CAS# | 391210-10-9 |
| SMILES | C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)NOC[C@@H](CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pd0325901.html |