ABT-737 10mM * 1mL in DMSO
ABT-737 is a pan-Bcl-2 inhibitor. IC50 values ranged from 192 nM (the pre-B cell line Hal-01) to <10 ??M (Nalm-6, K562 and HL-60).
| Trivial name | ABT-737 10mM * 1mL in DMSO |
| Catalog Number | A10255-10mM-D |
| Alternative Name(s) | 4-[4-[(4'-Chloro[1,1'-biphenyl]-2-yl)methyl]-1-piperazinyl]-N-[[4-[[(1R)-3-(dimethylamino)-1-[(phenylthio)methyl]propyl]amino]-3-nitrophenyl]sulfonyl]benzamide |
| Molecular Formula | C42H45ClN6O5S2 |
| CAS# | 852808-04-9 |
| SMILES | CN(C)CC[C@H](CSC1=CC=CC=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC(=O)C3=CC=C(C=C3)N4CCN(CC4)CC5=CC=CC=C5C6=CC=C(C=C6)Cl)[N+](=O)[O-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/abt-737.html |
