CYC116 10mM * 1mL in DMSO
Aurora kinase/VEGFR 2 inhibitor CYC116 inhibits Aurora kinases A and B and vascular endothelial growth factor receptor 2 (VEGFR2), resulting in disruption of the cell cycle, rapid cell death, and the inhibition of angiogenesis.
| Trivial name | CYC116 10mM * 1mL in DMSO |
| Catalog Number | A10248-10mM-D |
| Alternative Name(s) | 4-methyl-5-(2-(4-morpholinophenylamino)pyrimidin-4-yl)thiazol-2-amine |
| Molecular Formula | C18H20N6OS |
| CAS# | 693228-63-6 |
| SMILES | CC1=C(SC(=N1)N)C2=NC(=NC=C2)NC3=CC=C(C=C3)N4CCOCC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cyc116.html |