Crystal violet 10mM * 1mL in DMSO
Crystal violet is a triarylmethane dye. The dye is used as a histological stain and in Gram??s method of classifying bacteria.
Trivial name | Crystal violet 10mM * 1mL in DMSO |
Catalog Number | A10245-10mM-D |
Alternative Name(s) | Tris(4-(dimethylamino)phenyl)methylium chloride |
Molecular Formula | C25H30ClN3 |
CAS# | 548-62-9 |
SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/crystal-violet.html |