Cryptotanshinone 10mg
Cryptotanshinone, a natural compound isolated from the roots of Salvia miltiorrhiza Bunge (Danshen), dramatically blocks STAT3 Tyr705 phosphorylation but not STAT3 Ser727 phosphorylation in DU145 cells, and significantly inhibits JAK2 phosphorylation with IC50 of ~5 ??M without affecting the phosphorylation of upstream kinases c-Src and EGFR.
| Trivial name | Cryptotanshinone 10mg |
| Catalog Number | A10244-10 |
| Alternative Name(s) | (r)-1,2,6,7,8,9-hexahydro-1,6,6-trimethyl-phenanthro(1,2-b)furan-10,11-dione |
| Molecular Formula | C19H20O3 |
| CAS# | 35825-57-1 |
| SMILES | C[C@H]1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cryptotanshinone.html |