Clofibrate 500mg
Clofibrate increases the activity of extrahepatic lipoprotein lipase (LL), thereby increasing lipoprotein triglyceride lipolysis. Chylomicrons are degraded, VLDLs are converted to LDLs, and LDLs are converted to HDL.
| Trivial name | Clofibrate 500mg |
| Catalog Number | A10229-500 |
| Alternative Name(s) | ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| Molecular Formula | C12H15ClO3 |
| CAS# | 637-07-0 |
| SMILES | CCOC(=O)C(C)(C)OC1=CC=C(C=C1)Cl |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/clofibrate-atromid-s.html |
