Clemastine fumarate 10mM * 1mL in DMSO
Clemastine is a selective histamine H1 antagonist. It binds to the histamine H1 receptor, thus blocking the action of endogenous histamine, which leads to temporary relief of the negative symptoms caused by histamine.
Trivial name | Clemastine fumarate 10mM * 1mL in DMSO |
Catalog Number | A10226-10mM-D |
Alternative Name(s) | (2R)-2-[2-[(1R)-1-(4-Chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine but-2-enedioic acid |
Molecular Formula | C₂₁H₂₆ClNO.C₄H₄O₄ |
CAS# | 14976-57-9 |
SMILES | C[C@@](C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[C@H]3CCCN3C.C(=C/C(=O)O)C(=O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/clemastine-fumarate.html |