Clemastine fumarate 100mg
Clemastine is a selective histamine H1 antagonist. It binds to the histamine H1 receptor, thus blocking the action of endogenous histamine, which leads to temporary relief of the negative symptoms caused by histamine.
| Trivial name | Clemastine fumarate 100mg |
| Catalog Number | A10226-100 |
| Alternative Name(s) | (2R)-2-[2-[(1R)-1-(4-Chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine but-2-enedioic acid |
| Molecular Formula | C21H26ClNO.C4H4O4 |
| CAS# | 14976-57-9 |
| SMILES | C[C@@](C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[C@H]3CCCN3C.C(=C/C(=O)O)C(=O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/clemastine-fumarate.html |
