Cladribine 200mg
Cladribine is a synthetic anti-cancer agent that mimics the nucleoside adenosine and thus inhibits the enzyme adenosine deaminase, which interferes with the cell’s ability to process DNA.
Trivial name | Cladribine 200mg |
Catalog Number | A10223-200 |
Alternative Name(s) | 5-(6-amino-2-chloro-purin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
Molecular Formula | C₁₀H₁₂ClN₅O₃ |
CAS# | 4291-63-8 |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(N=C3N)Cl)CO)O |
Size | 200mg |
Supplier Page | http://www.adooq.com/cladribine.html |