AMG-073 HCl 50mg
AMG-073 HCl (Cinacalcet HCl) represents a new class of compounds for the treatment of hyperparathyroidism known as calcimimetics, which reduce parathyroid hormone (PTH) synthesis and secretion by increasing the sensitivity of the parathyroid calcium-sensing receptor (CaR) to extracellular calcium.
| Trivial name | AMG-073 HCl 50mg |
| Catalog Number | A10219-50 |
| Alternative Name(s) | N/A |
| Molecular Formula | C22H23ClF3N |
| CAS# | 364782-34-3 |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/amg-073-hcl-cinacalcet-hydrochloride.html |
