Cetirizine Dihydrochloride 200mg
Cetirizine is a second-generation antihistamine, a major metabolite of hydroxyzine, and a racemic selective H1 receptor inverse agonist used in the treatment of allergies, hay fever, angioedema, and urticaria.
| Trivial name | Cetirizine Dihydrochloride 200mg |
| Catalog Number | A10195-200 |
| Alternative Name(s) | 2-(2-(4-((4-chlorophenyl)(phenyl)methyl)piperazin-1-yl)ethoxy)acetic acid dihydrochloride |
| Molecular Formula | C21H25ClN2O3.2HCl |
| CAS# | 83881-52-1 |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/cetirizine-dihydrochloride.html |
