Cetirizine 2HCl 10mM * 1mL in DMSO
Cetirizine is a second-generation antihistamine, a major metabolite of hydroxyzine, and a racemic selective H1 receptor inverse agonist used in the treatment of allergies, hay fever, angioedema, and urticaria.
Trivial name | Cetirizine 2HCl 10mM * 1mL in DMSO |
Catalog Number | A10195-10mM-D |
Alternative Name(s) | 2-(2-(4-((4-chlorophenyl)(phenyl)methyl)piperazin-1-yl)ethoxy)acetic acid dihydrochloride |
Molecular Formula | C₂₁H₂₅ClN₂O₃.₂HCl |
CAS# | 83881-52-1 |
SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/cetirizine-dihydrochloride.html |