Celastrol 25mg
Celastrol is a triterpenoid antioxidant compound isolated from the Chinese Thunder of God vine (T. wilfordii). In an isolated rat liver assay of lipid peroxidation, celastrol had an IC50 value of 7 µM, equivalent to about 15 times the antioxidant potency of α-tocopherol.
| Trivial name | Celastrol 25mg |
| Catalog Number | A10192-25 |
| Alternative Name(s) | 3-?€?hydroxy-?€?9??,?€?13??-?€?dimethyl-?€?2-?€?oxo-?€?24,?€?25,?€?26-?€?trinoroleana-?€?1(10),?€?3,?€?5,?€?7-?€?tetraen-?€?29-?€?oic acid |
| Molecular Formula | C29H38O4 |
| CAS# | 34157-83-0 |
| SMILES | CC1=C(C(=O)C=C2C1=CC=C3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4C[C@](CC5)(C)C(=O)O)C)C)C)C)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/celastrol.html |
