Cefaclor 2000mg
Cefaclor is a second-generation cephalosporin antibiotic used to treat certain infections caused by bacteria such as pneumonia and ear, lung, skin, throat, and urinary tract infections.
| Trivial name | Cefaclor 2000mg |
| Catalog Number | A10186-2000 |
| Alternative Name(s) | (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}- 3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene- 2-carboxylic acid |
| Molecular Formula | C15H14ClN3O4S |
| CAS# | 53994-73-3 |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)Cl |
| Size | 2000mg |
| Supplier Page | http://www.adooq.com/cefaclor.html |
