Carbamazepine 10mM * 1mL in DMSO
Carbamazepine is an anticonvulsant and mood-stabilizing drug used primarily in the treatment of epilepsy and bipolar disorder, as well as trigeminal neuralgia.
| Trivial name | Carbamazepine 10mM * 1mL in DMSO |
| Catalog Number | A10179-10mM-D |
| Alternative Name(s) | 5H-dibenzo[b,f]azepine-5-carboxamide |
| Molecular Formula | C15H12N2O |
| CAS# | 298-46-4 |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/carbamazepine.html |
