Calcitriol 5mg
Calcitriol (Rocaltrol) increases blood calcium levels ( [Ca2+] ) by promoting absorption of dietary calcium from the gastrointestinal tract and increasing renal tubular reabsorption of calcium thus reducing the loss of calcium in the urine.
Trivial name | Calcitriol 5mg |
Catalog Number | A10173-5 |
Alternative Name(s) | (1R,3S)-5-[2-[(1R,3aR,7aS)-1-[(2R)-6-hydroxy-6-methyl-heptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H- inden-4-ylidene]ethylidene]-4-methylidene-cyclohexane-1,3-diol |
Molecular Formula | C27H44O3 |
CAS# | 32222-06-3 |
SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
Size | 5mg |
Supplier Page | http://www.adooq.com/calcitriol-rocaltrol.html |