BIX 02189 10mM * 1mL in DMSO
BIX 02189 is a selective dual MEK5 and ERK5 (or BMK1) kinase inhibitor, with IC50 values of 1.5, 59, 580 and >6200 nM for MEK5, ERK5, TGFbR1 and other closely related kinases respectively.
| Trivial name | BIX 02189 10mM * 1mL in DMSO |
| Catalog Number | A10151-10mM-D |
| Alternative Name(s) | 3-[[[3-[(Dimethylamino)methyl]phenyl]amino]phenylmethylene]-2,3-dihydro-N,N-dimethyl-2-oxo-1H-indole-6-carboxamide |
| Molecular Formula | C27H28N4O2 |
| CAS# | 1094614-85-3 |
| SMILES | CN(C)CC1=CC(=CC=C1)N/C(=C2/C3=C(C=C(C=C3)C(=O)N(C)C)NC2=O)/C4=CC=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bix-02189.html |
