Biochanin A 10mM * 1mL in DMSO
Biochanin A is an antiproliferative and anti-inflammatory agent that inhibits iNOS expression and lipopolysacharide (LPS)-induced nitric oxide production in macrophages. Additionally, Biochanin A displays the ability to block phosphorylation of IκBα and p38 MAPK, which prevents NF-κB activation. Furthermore, Biochanin A has been observed to suppress IL-6, IL-1β, and TNF-α production.
Trivial name | Biochanin A 10mM * 1mL in DMSO |
Catalog Number | A10146-10mM-D |
Alternative Name(s) | 5,7-Dihydroxy-4?€?-methoxyisoflavone, Genistein 4?€?-methyl ether |
Molecular Formula | C16H12O5 |
CAS# | 491-80-5 |
SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/biochanin-a-4-methylgenistein.html |